C23H23N5O3 — CID 138604593
3-N-(9-ethylcarbazol-3-yl)-2-N-(2-methoxyethyl)pyrazine-2,3-dicarboxamide (PubChem CID 138604593) has the molecular formula C23H23N5O3 and a molecular weight of 417.47 g/mol. Its IUPAC name is 3-N-(9-ethylcarbazol-3-yl)-2-N-(2-methoxyethyl)pyrazine-2,3-dicarboxamide.
| Compound Name | 3-N-(9-ethylcarbazol-3-yl)-2-N-(2-methoxyethyl)pyrazine-2,3-dicarboxamide |
|---|---|
| PubChem CID | 138604593 |
| Molecular Formula | C23H23N5O3 |
| Molecular Weight | 417.47 g/mol |
| Exact Mass | 417.18 |
| IUPAC Name | 3-N-(9-ethylcarbazol-3-yl)-2-N-(2-methoxyethyl)pyrazine-2,3-dicarboxamide |
| SMILES | CCn1c2ccccc2c2cc(NC(=O)c3nccnc3C(=O)NCCOC)ccc21 |
| InChI | InChI=1S/C23H23N5O3/c1-3-28-18-7-5-4-6-16(18)17-14-15(8-9-19(17)28)27-23(30)21-20(24-10-11-25-21)22(29)26-12-13-31-2/h4-11,14H,3,12-13H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | NLLWFHDUNPMNGM-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 98.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.47 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|