C25H33N3O4 — CID 25246811
N-(3-butoxypropyl)-2-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethoxy]acetamide (PubChem CID 25246811) has the molecular formula C25H33N3O4 and a molecular weight of 439.56 g/mol. Its IUPAC name is N-(3-butoxypropyl)-2-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethoxy]acetamide.
| Compound Name | N-(3-butoxypropyl)-2-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethoxy]acetamide |
|---|---|
| PubChem CID | 25246811 |
| Molecular Formula | C25H33N3O4 |
| Molecular Weight | 439.56 g/mol |
| Exact Mass | 439.25 |
| IUPAC Name | N-(3-butoxypropyl)-2-[2-[(9-ethylcarbazol-3-yl)amino]-2-oxoethoxy]acetamide |
| SMILES | CCCCOCCCNC(=O)COCC(=O)Nc1ccc2c(c1)c1ccccc1n2CC |
| InChI | InChI=1S/C25H33N3O4/c1-3-5-14-31-15-8-13-26-24(29)17-32-18-25(30)27-19-11-12-23-21(16-19)20-9-6-7-10-22(20)28(23)4-2/h6-7,9-12,16H,3-5,8,13-15,17-18H2,1-2H3,(H,26,29)(H,27,30) |
| InChIKey | TYNOBULJAXVHOK-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 81.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.56 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|