About 1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide
1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide (PubChem CID 138587588) has the molecular formula C20H21N5O2S
and a molecular weight of 395.49 g/mol. Its IUPAC name is 1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide.
Molecular Properties
| Compound Name | 1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide |
| PubChem CID | 138587588 |
| Molecular Formula | C20H21N5O2S |
| Molecular Weight | 395.49 g/mol |
| Exact Mass | 395.14 |
| IUPAC Name | 1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide |
| SMILES | O=C(Nc1ncc2ccc(-c3cncs3)cc2n1)C1CCN(C2COC2)CC1 |
| InChI | InChI=1S/C20H21N5O2S/c26-19(13-3-5-25(6-4-13)16-10-27-11-16)24-20-22-8-15-2-1-14(7-17(15)23-20)18-9-21-12-28-18/h1-2,7-9,12-13,16H,3-6,10-11H2,(H,22,23,24,26) |
| InChIKey | CASMRADBPXQGJP-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 80.24 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 395.49 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide?
The IUPAC name of 1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide (CID 138587588) is 1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide.
What is the SMILES notation for 1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide?
The canonical SMILES for 1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide is O=C(Nc1ncc2ccc(-c3cncs3)cc2n1)C1CCN(C2COC2)CC1.
What is the InChIKey of 1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide?
The InChIKey is CASMRADBPXQGJP-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H21N5O2S/c26-19(13-3-5-25(6-4-13)16-10-27-11-16)24-20-22-8-15-2-1-14(7-17(15)23-20)18-9-21-12-28-18/h1-2,7-9,12-13,16H,3-6,10-11H2,(H,22,23,24,26).
What are the key properties of 1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide?
1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide has a molecular weight of 395.49 g/mol, XLogP of 2.80, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(oxetan-3-yl)-N-[7-(1,3-thiazol-5-yl)quinazolin-2-yl]piperidine-4-carboxamide is sourced from PubChem (CID 138587588), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).