C18H19N7OS — CID 138588528
(1R,4R)-5-methyl-N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,6-naphthyridin-7-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxamide (PubChem CID 138588528) has the molecular formula C18H19N7OS and a molecular weight of 381.47 g/mol. Its IUPAC name is (1R,4R)-5-methyl-N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,6-naphthyridin-7-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxamide.
| Compound Name | (1R,4R)-5-methyl-N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,6-naphthyridin-7-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxamide |
|---|---|
| PubChem CID | 138588528 |
| Molecular Formula | C18H19N7OS |
| Molecular Weight | 381.47 g/mol |
| Exact Mass | 381.14 |
| IUPAC Name | (1R,4R)-5-methyl-N-[2-(5-methyl-1,3,4-thiadiazol-2-yl)-1,6-naphthyridin-7-yl]-2,5-diazabicyclo[2.2.1]heptane-2-carboxamide |
| SMILES | Cc1nnc(-c2ccc3cnc(NC(=O)N4C[C@H]5C[C@@H]4CN5C)cc3n2)s1 |
| InChI | InChI=1S/C18H19N7OS/c1-10-22-23-17(27-10)14-4-3-11-7-19-16(6-15(11)20-14)21-18(26)25-9-12-5-13(25)8-24(12)2/h3-4,6-7,12-13H,5,8-9H2,1-2H3,(H,19,21,26)/t12-,13-/m1/s1 |
| InChIKey | ZWWQALFSQXRKNJ-CHWSQXEVSA-N |
| XLogP | 2.38 |
| TPSA | 87.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.47 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |