C15H30N4O3 — CID 138591148
(2S)-2-[[(2S)-5-amino-2-(butanoylamino)pentanoyl]amino]-4-methylpentanamide (PubChem CID 138591148) has the molecular formula C15H30N4O3 and a molecular weight of 314.43 g/mol. Its IUPAC name is (2S)-2-[[(2S)-5-amino-2-(butanoylamino)pentanoyl]amino]-4-methylpentanamide.
| Compound Name | (2S)-2-[[(2S)-5-amino-2-(butanoylamino)pentanoyl]amino]-4-methylpentanamide |
|---|---|
| PubChem CID | 138591148 |
| Molecular Formula | C15H30N4O3 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.23 |
| IUPAC Name | (2S)-2-[[(2S)-5-amino-2-(butanoylamino)pentanoyl]amino]-4-methylpentanamide |
| SMILES | CCCC(=O)N[C@@H](CCCN)C(=O)N[C@@H](CC(C)C)C(N)=O |
| InChI | InChI=1S/C15H30N4O3/c1-4-6-13(20)18-11(7-5-8-16)15(22)19-12(14(17)21)9-10(2)3/h10-12H,4-9,16H2,1-3H3,(H2,17,21)(H,18,20)(H,19,22)/t11-,12-/m0/s1 |
| InChIKey | AHTMFCZXWPLVDX-RYUDHWBXSA-N |
| XLogP | 0.03 |
| TPSA | 127.31 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 0.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |