C14H26N4O5 — CID 138591553
[3-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-2-(butanoylamino)-3-oxopropyl]carbamic acid (PubChem CID 138591553) has the molecular formula C14H26N4O5 and a molecular weight of 330.39 g/mol. Its IUPAC name is [3-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-2-(butanoylamino)-3-oxopropyl]carbamic acid.
| Compound Name | [3-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-2-(butanoylamino)-3-oxopropyl]carbamic acid |
|---|---|
| PubChem CID | 138591553 |
| Molecular Formula | C14H26N4O5 |
| Molecular Weight | 330.39 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | [3-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-2-(butanoylamino)-3-oxopropyl]carbamic acid |
| SMILES | CCCC(=O)NC(CNC(=O)O)C(=O)NC(CC(C)C)C(N)=O |
| InChI | InChI=1S/C14H26N4O5/c1-4-5-11(19)17-10(7-16-14(22)23)13(21)18-9(12(15)20)6-8(2)3/h8-10,16H,4-7H2,1-3H3,(H2,15,20)(H,17,19)(H,18,21)(H,22,23) |
| InChIKey | CGTCGVPTXSUYMP-UHFFFAOYSA-N |
| XLogP | -0.44 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.39 |
| LogP ≤ 5 | -0.44 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |