C13H24N4O5 — CID 138591769
[3-acetamido-4-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-4-oxobutyl]carbamic acid (PubChem CID 138591769) has the molecular formula C13H24N4O5 and a molecular weight of 316.36 g/mol. Its IUPAC name is [3-acetamido-4-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-4-oxobutyl]carbamic acid.
| Compound Name | [3-acetamido-4-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-4-oxobutyl]carbamic acid |
|---|---|
| PubChem CID | 138591769 |
| Molecular Formula | C13H24N4O5 |
| Molecular Weight | 316.36 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | [3-acetamido-4-[(1-amino-4-methyl-1-oxopentan-2-yl)amino]-4-oxobutyl]carbamic acid |
| SMILES | CC(=O)NC(CCNC(=O)O)C(=O)NC(CC(C)C)C(N)=O |
| InChI | InChI=1S/C13H24N4O5/c1-7(2)6-10(11(14)19)17-12(20)9(16-8(3)18)4-5-15-13(21)22/h7,9-10,15H,4-6H2,1-3H3,(H2,14,19)(H,16,18)(H,17,20)(H,21,22) |
| InChIKey | ATTHUVFTZUDILL-UHFFFAOYSA-N |
| XLogP | -0.83 |
| TPSA | 150.62 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.36 |
| LogP ≤ 5 | -0.83 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 4 |