C24H36O3 — CID 138593441
3-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]-2,2-dimethylpropanoic acid (PubChem CID 138593441) has the molecular formula C24H36O3 and a molecular weight of 372.55 g/mol. Its IUPAC name is 3-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]-2,2-dimethylpropanoic acid.
| Compound Name | 3-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]-2,2-dimethylpropanoic acid |
|---|---|
| PubChem CID | 138593441 |
| Molecular Formula | C24H36O3 |
| Molecular Weight | 372.55 g/mol |
| Exact Mass | 372.27 |
| IUPAC Name | 3-[(3S,8R,9S,10R,13S,14S)-10,13-dimethyl-17-oxo-1,2,3,4,7,8,9,11,12,14,15,16-dodecahydrocyclopenta[a]phenanthren-3-yl]-2,2-dimethylpropanoic acid |
| SMILES | CC(C)(C[C@H]1CC[C@@]2(C)C(=CC[C@@H]3[C@@H]2CC[C@]2(C)C(=O)CC[C@@H]32)C1)C(=O)O |
| InChI | InChI=1S/C24H36O3/c1-22(2,21(26)27)14-15-9-11-23(3)16(13-15)5-6-17-18-7-8-20(25)24(18,4)12-10-19(17)23/h5,15,17-19H,6-14H2,1-4H3,(H,26,27)/t15-,17-,18-,19-,23-,24-/m0/s1 |
| InChIKey | HKNHDSKJAZBTHX-WOEKQQBKSA-N |
| XLogP | 5.64 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.55 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|