C30H41N5O3 — CID 138594836
tert-butyl 2-[[1'-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)spiro[2H-indole-3,4'-piperidine]-1-yl]methyl]pyrrolidine-1-carboxylate (PubChem CID 138594836) has the molecular formula C30H41N5O3 and a molecular weight of 519.69 g/mol. Its IUPAC name is tert-butyl 2-[[1'-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)spiro[2H-indole-3,4'-piperidine]-1-yl]methyl]pyrrolidine-1-carboxylate.
| Compound Name | tert-butyl 2-[[1'-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)spiro[2H-indole-3,4'-piperidine]-1-yl]methyl]pyrrolidine-1-carboxylate |
|---|---|
| PubChem CID | 138594836 |
| Molecular Formula | C30H41N5O3 |
| Molecular Weight | 519.69 g/mol |
| Exact Mass | 519.32 |
| IUPAC Name | tert-butyl 2-[[1'-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)spiro[2H-indole-3,4'-piperidine]-1-yl]methyl]pyrrolidine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCCC1CN1CC2(CCN(c3nc4c(c(=O)[nH]3)CCCC4)CC2)c2ccccc21 |
| InChI | InChI=1S/C30H41N5O3/c1-29(2,3)38-28(37)35-16-8-9-21(35)19-34-20-30(23-11-5-7-13-25(23)34)14-17-33(18-15-30)27-31-24-12-6-4-10-22(24)26(36)32-27/h5,7,11,13,21H,4,6,8-10,12,14-20H2,1-3H3,(H,31,32,36) |
| InChIKey | KIVRMVMHQDEYHK-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 81.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.69 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |