C24H29F2N5O2 — CID 138595170
N-[2-[4,6-difluoro-1'-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethyl]acetamide (PubChem CID 138595170) has the molecular formula C24H29F2N5O2 and a molecular weight of 457.53 g/mol. Its IUPAC name is N-[2-[4,6-difluoro-1'-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethyl]acetamide.
| Compound Name | N-[2-[4,6-difluoro-1'-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethyl]acetamide |
|---|---|
| PubChem CID | 138595170 |
| Molecular Formula | C24H29F2N5O2 |
| Molecular Weight | 457.53 g/mol |
| Exact Mass | 457.23 |
| IUPAC Name | N-[2-[4,6-difluoro-1'-(4-oxo-5,6,7,8-tetrahydro-3H-quinazolin-2-yl)spiro[2H-indole-3,4'-piperidine]-1-yl]ethyl]acetamide |
| SMILES | CC(=O)NCCN1CC2(CCN(c3nc4c(c(=O)[nH]3)CCCC4)CC2)c2c(F)cc(F)cc21 |
| InChI | InChI=1S/C24H29F2N5O2/c1-15(32)27-8-11-31-14-24(21-18(26)12-16(25)13-20(21)31)6-9-30(10-7-24)23-28-19-5-3-2-4-17(19)22(33)29-23/h12-13H,2-11,14H2,1H3,(H,27,32)(H,28,29,33) |
| InChIKey | SHPCVRILGHOXTH-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 81.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.53 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |