C27H29F2N5O — CID 138594546
2-[1-[(3-aminophenyl)methyl]-4,6-difluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-5,6,7,8-tetrahydro-3H-quinazolin-4-one (PubChem CID 138594546) has the molecular formula C27H29F2N5O and a molecular weight of 477.56 g/mol. Its IUPAC name is 2-[1-[(3-aminophenyl)methyl]-4,6-difluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-5,6,7,8-tetrahydro-3H-quinazolin-4-one.
| Compound Name | 2-[1-[(3-aminophenyl)methyl]-4,6-difluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
|---|---|
| PubChem CID | 138594546 |
| Molecular Formula | C27H29F2N5O |
| Molecular Weight | 477.56 g/mol |
| Exact Mass | 477.23 |
| IUPAC Name | 2-[1-[(3-aminophenyl)methyl]-4,6-difluorospiro[2H-indole-3,4'-piperidine]-1'-yl]-5,6,7,8-tetrahydro-3H-quinazolin-4-one |
| SMILES | Nc1cccc(CN2CC3(CCN(c4nc5c(c(=O)[nH]4)CCCC5)CC3)c3c(F)cc(F)cc32)c1 |
| InChI | InChI=1S/C27H29F2N5O/c28-18-13-21(29)24-23(14-18)34(15-17-4-3-5-19(30)12-17)16-27(24)8-10-33(11-9-27)26-31-22-7-2-1-6-20(22)25(35)32-26/h3-5,12-14H,1-2,6-11,15-16,30H2,(H,31,32,35) |
| InChIKey | CWRUXVXTMYOMPM-UHFFFAOYSA-N |
| XLogP | 4.07 |
| TPSA | 78.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.56 |
| LogP ≤ 5 | 4.07 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|