C10H16N2O — CID 138595567
3-[methyl(1H-pyrrol-3-yl)amino]cyclopentan-1-ol (PubChem CID 138595567) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is 3-[methyl(1H-pyrrol-3-yl)amino]cyclopentan-1-ol.
| Compound Name | 3-[methyl(1H-pyrrol-3-yl)amino]cyclopentan-1-ol |
|---|---|
| PubChem CID | 138595567 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | 3-[methyl(1H-pyrrol-3-yl)amino]cyclopentan-1-ol |
| SMILES | CN(c1cc[nH]c1)C1CCC(O)C1 |
| InChI | InChI=1S/C10H16N2O/c1-12(9-4-5-11-7-9)8-2-3-10(13)6-8/h4-5,7-8,10-11,13H,2-3,6H2,1H3 |
| InChIKey | NZMPXPHCCIGVHF-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 39.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |