C20H20F2N4O4 — CID 138598254
N-[(1R,2R)-2-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,3-dioxoisoindol-2-yl]cyclohexyl]propanamide (PubChem CID 138598254) has the molecular formula C20H20F2N4O4 and a molecular weight of 418.40 g/mol. Its IUPAC name is N-[(1R,2R)-2-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,3-dioxoisoindol-2-yl]cyclohexyl]propanamide.
| Compound Name | N-[(1R,2R)-2-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,3-dioxoisoindol-2-yl]cyclohexyl]propanamide |
|---|---|
| PubChem CID | 138598254 |
| Molecular Formula | C20H20F2N4O4 |
| Molecular Weight | 418.40 g/mol |
| Exact Mass | 418.15 |
| IUPAC Name | N-[(1R,2R)-2-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-1,3-dioxoisoindol-2-yl]cyclohexyl]propanamide |
| SMILES | CCC(=O)N[C@@H]1CCCC[C@H]1N1C(=O)c2ccc(-c3nnc(C(F)F)o3)cc2C1=O |
| InChI | InChI=1S/C20H20F2N4O4/c1-2-15(27)23-13-5-3-4-6-14(13)26-19(28)11-8-7-10(9-12(11)20(26)29)17-24-25-18(30-17)16(21)22/h7-9,13-14,16H,2-6H2,1H3,(H,23,27)/t13-,14-/m1/s1 |
| InChIKey | JILAMAKNVZFCHJ-ZIAGYGMSSA-N |
| XLogP | 3.11 |
| TPSA | 105.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.40 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|