C20H17F7N4O3 — CID 162611446
N-[(1R)-2-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-oxo-1H-isoindol-2-yl]cyclohexyl]-2,2,3,3,3-pentafluoropropanamide (PubChem CID 162611446) has the molecular formula C20H17F7N4O3 and a molecular weight of 494.37 g/mol. Its IUPAC name is N-[(1R)-2-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-oxo-1H-isoindol-2-yl]cyclohexyl]-2,2,3,3,3-pentafluoropropanamide.
| Compound Name | N-[(1R)-2-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-oxo-1H-isoindol-2-yl]cyclohexyl]-2,2,3,3,3-pentafluoropropanamide |
|---|---|
| PubChem CID | 162611446 |
| Molecular Formula | C20H17F7N4O3 |
| Molecular Weight | 494.37 g/mol |
| Exact Mass | 494.12 |
| IUPAC Name | N-[(1R)-2-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-oxo-1H-isoindol-2-yl]cyclohexyl]-2,2,3,3,3-pentafluoropropanamide |
| SMILES | O=C1c2cc(-c3nnc(C(F)F)o3)ccc2CN1C1CCCC[C@H]1NC(=O)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C20H17F7N4O3/c21-14(22)16-30-29-15(34-16)9-5-6-10-8-31(17(32)11(10)7-9)13-4-2-1-3-12(13)28-18(33)19(23,24)20(25,26)27/h5-7,12-14H,1-4,8H2,(H,28,33)/t12-,13?/m1/s1 |
| InChIKey | BJBFMZNGTHTTLR-PZORYLMUSA-N |
| XLogP | 4.26 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 494.37 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|