C20H16F8N4O3 — CID 138598272
N-[(1R,2R)-2-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-oxo-1H-isoindol-2-yl]-4,4-difluorocyclohexyl]-2,2,3,3-tetrafluoropropanamide (PubChem CID 138598272) has the molecular formula C20H16F8N4O3 and a molecular weight of 512.36 g/mol. Its IUPAC name is N-[(1R,2R)-2-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-oxo-1H-isoindol-2-yl]-4,4-difluorocyclohexyl]-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-[(1R,2R)-2-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-oxo-1H-isoindol-2-yl]-4,4-difluorocyclohexyl]-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 138598272 |
| Molecular Formula | C20H16F8N4O3 |
| Molecular Weight | 512.36 g/mol |
| Exact Mass | 512.11 |
| IUPAC Name | N-[(1R,2R)-2-[5-[5-(difluoromethyl)-1,3,4-oxadiazol-2-yl]-3-oxo-1H-isoindol-2-yl]-4,4-difluorocyclohexyl]-2,2,3,3-tetrafluoropropanamide |
| SMILES | O=C1c2cc(-c3nnc(C(F)F)o3)ccc2CN1[C@@H]1CC(F)(F)CC[C@H]1NC(=O)C(F)(F)C(F)F |
| InChI | InChI=1S/C20H16F8N4O3/c21-13(22)15-31-30-14(35-15)8-1-2-9-7-32(16(33)10(9)5-8)12-6-19(25,26)4-3-11(12)29-18(34)20(27,28)17(23)24/h1-2,5,11-13,17H,3-4,6-7H2,(H,29,34)/t11-,12-/m1/s1 |
| InChIKey | XVRBVHXSWFZDDH-VXGBXAGGSA-N |
| XLogP | 4.20 |
| TPSA | 88.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.36 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|