C37H56O6 — CID 138598797
[4-[7-[4-(3-ethoxyphenoxy)-2-methylbutan-2-yl]oxy-2,3,3-trimethylheptan-2-yl]oxy-2-methyl-3-phenylbutan-2-yl] prop-2-enoate (PubChem CID 138598797) has the molecular formula C37H56O6 and a molecular weight of 596.85 g/mol. Its IUPAC name is [4-[7-[4-(3-ethoxyphenoxy)-2-methylbutan-2-yl]oxy-2,3,3-trimethylheptan-2-yl]oxy-2-methyl-3-phenylbutan-2-yl] prop-2-enoate.
| Compound Name | [4-[7-[4-(3-ethoxyphenoxy)-2-methylbutan-2-yl]oxy-2,3,3-trimethylheptan-2-yl]oxy-2-methyl-3-phenylbutan-2-yl] prop-2-enoate |
|---|---|
| PubChem CID | 138598797 |
| Molecular Formula | C37H56O6 |
| Molecular Weight | 596.85 g/mol |
| Exact Mass | 596.41 |
| IUPAC Name | [4-[7-[4-(3-ethoxyphenoxy)-2-methylbutan-2-yl]oxy-2,3,3-trimethylheptan-2-yl]oxy-2-methyl-3-phenylbutan-2-yl] prop-2-enoate |
| SMILES | C=CC(=O)OC(C)(C)C(COC(C)(C)C(C)(C)CCCCOC(C)(C)CCOc1cccc(OCC)c1)c1ccccc1 |
| InChI | InChI=1S/C37H56O6/c1-11-33(38)43-36(7,8)32(29-19-14-13-15-20-29)28-42-37(9,10)34(3,4)23-16-17-25-41-35(5,6)24-26-40-31-22-18-21-30(27-31)39-12-2/h11,13-15,18-22,27,32H,1,12,16-17,23-26,28H2,2-10H3 |
| InChIKey | YPRUIYHBMYENAM-UHFFFAOYSA-N |
| XLogP | 8.93 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 596.85 |
| LogP ≤ 5 | 8.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|