C17H24O6 — CID 139774262
(2,2,2-triethoxy-1-phenoxyethyl) prop-2-enoate (PubChem CID 139774262) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is (2,2,2-triethoxy-1-phenoxyethyl) prop-2-enoate.
| Compound Name | (2,2,2-triethoxy-1-phenoxyethyl) prop-2-enoate |
|---|---|
| PubChem CID | 139774262 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | (2,2,2-triethoxy-1-phenoxyethyl) prop-2-enoate |
| SMILES | C=CC(=O)OC(Oc1ccccc1)C(OCC)(OCC)OCC |
| InChI | InChI=1S/C17H24O6/c1-5-15(18)23-16(22-14-12-10-9-11-13-14)17(19-6-2,20-7-3)21-8-4/h5,9-13,16H,1,6-8H2,2-4H3 |
| InChIKey | YGJZXJLSUBIQGU-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|