About chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium
chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium (PubChem CID 158829603) has the molecular formula C15H23ClNO2+
and a molecular weight of 284.81 g/mol. Its IUPAC name is chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium.
Molecular Properties
| Compound Name | chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium |
| PubChem CID | 158829603 |
| Molecular Formula | C15H23ClNO2+ |
| Molecular Weight | 284.81 g/mol |
| Exact Mass | 284.14 |
| IUPAC Name | chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium |
| SMILES | C=CC(=O)OC(c1ccccc1)[N+](C)(C)CC.CCl |
| InChI | InChI=1S/C14H20NO2.CH3Cl/c1-5-13(16)17-14(15(3,4)6-2)12-10-8-7-9-11-12;1-2/h5,7-11,14H,1,6H2,2-4H3;1H3/q+1; |
| InChIKey | IWWMRDGPQDEAOE-UHFFFAOYSA-N |
| XLogP | 3.37 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.81 |
| LogP ≤ 5 | 3.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium?
The IUPAC name of chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium (CID 158829603) is chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium.
What is the SMILES notation for chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium?
The canonical SMILES for chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium is C=CC(=O)OC(c1ccccc1)[N+](C)(C)CC.CCl.
What is the InChIKey of chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium?
The InChIKey is IWWMRDGPQDEAOE-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20NO2.CH3Cl/c1-5-13(16)17-14(15(3,4)6-2)12-10-8-7-9-11-12;1-2/h5,7-11,14H,1,6H2,2-4H3;1H3/q+1;.
What are the key properties of chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium?
chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium has a molecular weight of 284.81 g/mol, XLogP of 3.37, 5 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;ethyl-dimethyl-[phenyl(prop-2-enoyloxy)methyl]azanium is sourced from PubChem (CID 158829603), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).