C16H24ClNO2 — CID 175094010
[1-(dimethylamino)-1-phenylpentan-2-yl] prop-2-enoate;hydrochloride (PubChem CID 175094010) has the molecular formula C16H24ClNO2 and a molecular weight of 297.83 g/mol. Its IUPAC name is [1-(dimethylamino)-1-phenylpentan-2-yl] prop-2-enoate;hydrochloride.
| Compound Name | [1-(dimethylamino)-1-phenylpentan-2-yl] prop-2-enoate;hydrochloride |
|---|---|
| PubChem CID | 175094010 |
| Molecular Formula | C16H24ClNO2 |
| Molecular Weight | 297.83 g/mol |
| Exact Mass | 297.15 |
| IUPAC Name | [1-(dimethylamino)-1-phenylpentan-2-yl] prop-2-enoate;hydrochloride |
| SMILES | C=CC(=O)OC(CCC)C(c1ccccc1)N(C)C.Cl |
| InChI | InChI=1S/C16H23NO2.ClH/c1-5-10-14(19-15(18)6-2)16(17(3)4)13-11-8-7-9-12-13;/h6-9,11-12,14,16H,2,5,10H2,1,3-4H3;1H |
| InChIKey | AGNXRZLMNGBFGE-UHFFFAOYSA-N |
| XLogP | 3.61 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.83 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|