C15H22NO2+ — CID 174601755
benzyl-dimethyl-(1-prop-2-enoyloxypropyl)azanium (PubChem CID 174601755) has the molecular formula C15H22NO2+ and a molecular weight of 248.35 g/mol. Its IUPAC name is benzyl-dimethyl-(1-prop-2-enoyloxypropyl)azanium.
| Compound Name | benzyl-dimethyl-(1-prop-2-enoyloxypropyl)azanium |
|---|---|
| PubChem CID | 174601755 |
| Molecular Formula | C15H22NO2+ |
| Molecular Weight | 248.35 g/mol |
| Exact Mass | 248.16 |
| IUPAC Name | benzyl-dimethyl-(1-prop-2-enoyloxypropyl)azanium |
| SMILES | C=CC(=O)OC(CC)[N+](C)(C)Cc1ccccc1 |
| InChI | InChI=1S/C15H22NO2/c1-5-14(18-15(17)6-2)16(3,4)12-13-10-8-7-9-11-13/h6-11,14H,2,5,12H2,1,3-4H3/q+1 |
| InChIKey | YVSHFIPUCAVHJS-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.35 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|