C17H26BrNO2 — CID 142712837
benzyl-dimethyl-[1-(2-methylprop-2-enoyloxy)butyl]azanium bromide (PubChem CID 142712837) has the molecular formula C17H26BrNO2 and a molecular weight of 356.30 g/mol. Its IUPAC name is benzyl-dimethyl-[1-(2-methylprop-2-enoyloxy)butyl]azanium bromide.
| Compound Name | benzyl-dimethyl-[1-(2-methylprop-2-enoyloxy)butyl]azanium bromide |
|---|---|
| PubChem CID | 142712837 |
| Molecular Formula | C17H26BrNO2 |
| Molecular Weight | 356.30 g/mol |
| Exact Mass | 355.11 |
| IUPAC Name | benzyl-dimethyl-[1-(2-methylprop-2-enoyloxy)butyl]azanium bromide |
| SMILES | C=C(C)C(=O)OC(CCC)[N+](C)(C)Cc1ccccc1.[Br-] |
| InChI | InChI=1S/C17H26NO2.BrH/c1-6-10-16(20-17(19)14(2)3)18(4,5)13-15-11-8-7-9-12-15;/h7-9,11-12,16H,2,6,10,13H2,1,3-5H3;1H/q+1;/p-1 |
| InChIKey | PFKMBMQKYURQKD-UHFFFAOYSA-M |
| XLogP | 0.51 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.30 |
| LogP ≤ 5 | 0.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|