About (2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate
(2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate (PubChem CID 67822901) has the molecular formula C16H20O4
and a molecular weight of 276.33 g/mol. Its IUPAC name is (2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate.
Molecular Properties
| Compound Name | (2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate |
| PubChem CID | 67822901 |
| Molecular Formula | C16H20O4 |
| Molecular Weight | 276.33 g/mol |
| Exact Mass | 276.14 |
| IUPAC Name | (2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate |
| SMILES | C=C(C)C(=O)OC(OCCC)C(=O)Cc1ccccc1 |
| InChI | InChI=1S/C16H20O4/c1-4-10-19-16(20-15(18)12(2)3)14(17)11-13-8-6-5-7-9-13/h5-9,16H,2,4,10-11H2,1,3H3 |
| InChIKey | SDFSIKQGPOUKSM-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 276.33 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate?
The IUPAC name of (2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate (CID 67822901) is (2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate.
What is the SMILES notation for (2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate?
The canonical SMILES for (2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate is C=C(C)C(=O)OC(OCCC)C(=O)Cc1ccccc1.
What is the InChIKey of (2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate?
The InChIKey is SDFSIKQGPOUKSM-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H20O4/c1-4-10-19-16(20-15(18)12(2)3)14(17)11-13-8-6-5-7-9-13/h5-9,16H,2,4,10-11H2,1,3H3.
What are the key properties of (2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate?
(2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate has a molecular weight of 276.33 g/mol, XLogP of 2.67, 8 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for (2-oxo-3-phenyl-1-propoxypropyl) 2-methylprop-2-enoate is sourced from PubChem (CID 67822901), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).