C21H32ClNO2 — CID 174813072
3-benzylpent-1-en-3-yl-dimethyl-[1-(2-methylprop-2-enoyloxy)propyl]azanium chloride (PubChem CID 174813072) has the molecular formula C21H32ClNO2 and a molecular weight of 365.95 g/mol. Its IUPAC name is 3-benzylpent-1-en-3-yl-dimethyl-[1-(2-methylprop-2-enoyloxy)propyl]azanium chloride.
| Compound Name | 3-benzylpent-1-en-3-yl-dimethyl-[1-(2-methylprop-2-enoyloxy)propyl]azanium chloride |
|---|---|
| PubChem CID | 174813072 |
| Molecular Formula | C21H32ClNO2 |
| Molecular Weight | 365.95 g/mol |
| Exact Mass | 365.21 |
| IUPAC Name | 3-benzylpent-1-en-3-yl-dimethyl-[1-(2-methylprop-2-enoyloxy)propyl]azanium chloride |
| SMILES | C=CC(CC)(Cc1ccccc1)[N+](C)(C)C(CC)OC(=O)C(=C)C.[Cl-] |
| InChI | InChI=1S/C21H32NO2.ClH/c1-8-19(24-20(23)17(4)5)22(6,7)21(9-2,10-3)16-18-14-12-11-13-15-18;/h9,11-15,19H,2,4,8,10,16H2,1,3,5-7H3;1H/q+1;/p-1 |
| InChIKey | ZGDBXTDQYXVOMX-UHFFFAOYSA-M |
| XLogP | 1.50 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.95 |
| LogP ≤ 5 | 1.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|