C17H24NO2+ — CID 174548375
benzyl-methyl-(1-prop-2-enoyloxypropyl)-prop-2-enylazanium (PubChem CID 174548375) has the molecular formula C17H24NO2+ and a molecular weight of 274.38 g/mol. Its IUPAC name is benzyl-methyl-(1-prop-2-enoyloxypropyl)-prop-2-enylazanium.
| Compound Name | benzyl-methyl-(1-prop-2-enoyloxypropyl)-prop-2-enylazanium |
|---|---|
| PubChem CID | 174548375 |
| Molecular Formula | C17H24NO2+ |
| Molecular Weight | 274.38 g/mol |
| Exact Mass | 274.18 |
| IUPAC Name | benzyl-methyl-(1-prop-2-enoyloxypropyl)-prop-2-enylazanium |
| SMILES | C=CC[N+](C)(Cc1ccccc1)C(CC)OC(=O)C=C |
| InChI | InChI=1S/C17H24NO2/c1-5-13-18(4,14-15-11-9-8-10-12-15)16(6-2)20-17(19)7-3/h5,7-12,16H,1,3,6,13-14H2,2,4H3/q+1 |
| InChIKey | HRUDVAHXASMSAI-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.38 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|