C20H26BrNO2 — CID 139075132
(S)-benzyl-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]-methyl-prop-2-enylazanium bromide (PubChem CID 139075132) has the molecular formula C20H26BrNO2 and a molecular weight of 392.34 g/mol. Its IUPAC name is (S)-benzyl-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]-methyl-prop-2-enylazanium bromide.
| Compound Name | (S)-benzyl-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]-methyl-prop-2-enylazanium bromide |
|---|---|
| PubChem CID | 139075132 |
| Molecular Formula | C20H26BrNO2 |
| Molecular Weight | 392.34 g/mol |
| Exact Mass | 391.11 |
| IUPAC Name | (S)-benzyl-[(2S)-1-hydroxy-3-(4-hydroxyphenyl)propan-2-yl]-methyl-prop-2-enylazanium bromide |
| SMILES | C=CC[N@@+](C)(Cc1ccccc1)[C@H](CO)Cc1ccc(O)cc1.[Br-] |
| InChI | InChI=1S/C20H25NO2.BrH/c1-3-13-21(2,15-18-7-5-4-6-8-18)19(16-22)14-17-9-11-20(23)12-10-17;/h3-12,19,22H,1,13-16H2,2H3;1H/t19-,21-;/m0./s1 |
| InChIKey | WFGAVHWMVNFSSD-RQBPZYBGSA-N |
| XLogP | 0.13 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.34 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|