C18H26ClNO2 — CID 174550914
benzyl-methyl-(2-prop-2-enoyloxybutan-2-yl)-prop-2-enylazanium chloride (PubChem CID 174550914) has the molecular formula C18H26ClNO2 and a molecular weight of 323.86 g/mol. Its IUPAC name is benzyl-methyl-(2-prop-2-enoyloxybutan-2-yl)-prop-2-enylazanium chloride.
| Compound Name | benzyl-methyl-(2-prop-2-enoyloxybutan-2-yl)-prop-2-enylazanium chloride |
|---|---|
| PubChem CID | 174550914 |
| Molecular Formula | C18H26ClNO2 |
| Molecular Weight | 323.86 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | benzyl-methyl-(2-prop-2-enoyloxybutan-2-yl)-prop-2-enylazanium chloride |
| SMILES | C=CC[N+](C)(Cc1ccccc1)C(C)(CC)OC(=O)C=C.[Cl-] |
| InChI | InChI=1S/C18H26NO2.ClH/c1-6-14-19(5,15-16-12-10-9-11-13-16)18(4,8-3)21-17(20)7-2;/h6-7,9-13H,1-2,8,14-15H2,3-5H3;1H/q+1;/p-1 |
| InChIKey | CNYMWYOOYOWONB-UHFFFAOYSA-M |
| XLogP | 0.68 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.86 |
| LogP ≤ 5 | 0.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|