C36H34O8 — CID 89187894
[1-phenoxy-1-[4-[4-(1-phenoxy-1-prop-2-enoyloxypropoxy)phenyl]phenoxy]propyl] prop-2-enoate (PubChem CID 89187894) has the molecular formula C36H34O8 and a molecular weight of 594.66 g/mol. Its IUPAC name is [1-phenoxy-1-[4-[4-(1-phenoxy-1-prop-2-enoyloxypropoxy)phenyl]phenoxy]propyl] prop-2-enoate.
| Compound Name | [1-phenoxy-1-[4-[4-(1-phenoxy-1-prop-2-enoyloxypropoxy)phenyl]phenoxy]propyl] prop-2-enoate |
|---|---|
| PubChem CID | 89187894 |
| Molecular Formula | C36H34O8 |
| Molecular Weight | 594.66 g/mol |
| Exact Mass | 594.23 |
| IUPAC Name | [1-phenoxy-1-[4-[4-(1-phenoxy-1-prop-2-enoyloxypropoxy)phenyl]phenoxy]propyl] prop-2-enoate |
| SMILES | C=CC(=O)OC(CC)(Oc1ccccc1)Oc1ccc(-c2ccc(OC(CC)(OC(=O)C=C)Oc3ccccc3)cc2)cc1 |
| InChI | InChI=1S/C36H34O8/c1-5-33(37)43-35(7-3,39-29-15-11-9-12-16-29)41-31-23-19-27(20-24-31)28-21-25-32(26-22-28)42-36(8-4,44-34(38)6-2)40-30-17-13-10-14-18-30/h5-6,9-26H,1-2,7-8H2,3-4H3 |
| InChIKey | ZFARAFPPUNPAII-UHFFFAOYSA-N |
| XLogP | 7.86 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 594.66 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|