C16H24NO2+ — CID 158895838
dimethyl-(1-phenyl-1-prop-2-enoyloxyethyl)-propylazanium (PubChem CID 158895838) has the molecular formula C16H24NO2+ and a molecular weight of 262.37 g/mol. Its IUPAC name is dimethyl-(1-phenyl-1-prop-2-enoyloxyethyl)-propylazanium.
| Compound Name | dimethyl-(1-phenyl-1-prop-2-enoyloxyethyl)-propylazanium |
|---|---|
| PubChem CID | 158895838 |
| Molecular Formula | C16H24NO2+ |
| Molecular Weight | 262.37 g/mol |
| Exact Mass | 262.18 |
| IUPAC Name | dimethyl-(1-phenyl-1-prop-2-enoyloxyethyl)-propylazanium |
| SMILES | C=CC(=O)OC(C)(c1ccccc1)[N+](C)(C)CCC |
| InChI | InChI=1S/C16H24NO2/c1-6-13-17(4,5)16(3,19-15(18)7-2)14-11-9-8-10-12-14/h7-12H,2,6,13H2,1,3-5H3/q+1 |
| InChIKey | LNDOFOUCIUYABP-UHFFFAOYSA-N |
| XLogP | 3.07 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 262.37 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|