C13H20N+ — CID 22066560
ethyl-dimethyl-(1-phenylprop-2-enyl)azanium (PubChem CID 22066560) has the molecular formula C13H20N+ and a molecular weight of 190.31 g/mol. Its IUPAC name is ethyl-dimethyl-(1-phenylprop-2-enyl)azanium.
| Compound Name | ethyl-dimethyl-(1-phenylprop-2-enyl)azanium |
|---|---|
| PubChem CID | 22066560 |
| Molecular Formula | C13H20N+ |
| Molecular Weight | 190.31 g/mol |
| Exact Mass | 190.16 |
| IUPAC Name | ethyl-dimethyl-(1-phenylprop-2-enyl)azanium |
| SMILES | C=CC(c1ccccc1)[N+](C)(C)CC |
| InChI | InChI=1S/C13H20N/c1-5-13(14(3,4)6-2)12-10-8-7-9-11-12/h5,7-11,13H,1,6H2,2-4H3/q+1 |
| InChIKey | JAXKEWUYNUGGSC-UHFFFAOYSA-N |
| XLogP | 3.01 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 190.31 |
| LogP ≤ 5 | 3.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|