About benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride
benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride (PubChem CID 86735557) has the molecular formula C25H29ClN2
and a molecular weight of 392.97 g/mol. Its IUPAC name is benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride.
Molecular Properties
| Compound Name | benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride |
| PubChem CID | 86735557 |
| Molecular Formula | C25H29ClN2 |
| Molecular Weight | 392.97 g/mol |
| Exact Mass | 392.20 |
| IUPAC Name | benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride |
| SMILES | C=CC(c1ccccc1)[N+](C)(C)Cc1ccccc1.C=Cc1ccncc1.[Cl-] |
| InChI | InChI=1S/C18H22N.C7H7N.ClH/c1-4-18(17-13-9-6-10-14-17)19(2,3)15-16-11-7-5-8-12-16;1-2-7-3-5-8-6-4-7;/h4-14,18H,1,15H2,2-3H3;2-6H,1H2;1H/q+1;;/p-1 |
| InChIKey | XCKABSWPVPDBET-UHFFFAOYSA-M |
| XLogP | 2.92 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 392.97 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride?
The IUPAC name of benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride (CID 86735557) is benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride.
What is the SMILES notation for benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride?
The canonical SMILES for benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride is C=CC(c1ccccc1)[N+](C)(C)Cc1ccccc1.C=Cc1ccncc1.[Cl-].
What is the InChIKey of benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride?
The InChIKey is XCKABSWPVPDBET-UHFFFAOYSA-M. The full InChI is InChI=1S/C18H22N.C7H7N.ClH/c1-4-18(17-13-9-6-10-14-17)19(2,3)15-16-11-7-5-8-12-16;1-2-7-3-5-8-6-4-7;/h4-14,18H,1,15H2,2-3H3;2-6H,1H2;1H/q+1;;/p-1.
What are the key properties of benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride?
benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride has a molecular weight of 392.97 g/mol, XLogP of 2.92, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-dimethyl-(1-phenylprop-2-enyl)azanium;4-ethenylpyridine;chloride is sourced from PubChem (CID 86735557), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).