C12H20ClNO — CID 139855182
benzyl-(1-hydroxypropyl)-dimethylazanium chloride (PubChem CID 139855182) has the molecular formula C12H20ClNO and a molecular weight of 229.75 g/mol. Its IUPAC name is benzyl-(1-hydroxypropyl)-dimethylazanium chloride.
| Compound Name | benzyl-(1-hydroxypropyl)-dimethylazanium chloride |
|---|---|
| PubChem CID | 139855182 |
| Molecular Formula | C12H20ClNO |
| Molecular Weight | 229.75 g/mol |
| Exact Mass | 229.12 |
| IUPAC Name | benzyl-(1-hydroxypropyl)-dimethylazanium chloride |
| SMILES | CCC(O)[N+](C)(C)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C12H20NO.ClH/c1-4-12(14)13(2,3)10-11-8-6-5-7-9-11;/h5-9,12,14H,4,10H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | ORAPSDLBKAANFN-UHFFFAOYSA-M |
| XLogP | -1.00 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 229.75 |
| LogP ≤ 5 | -1.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|