C12H19Cl2NO — CID 174737498
benzyl-(1-chloro-2-hydroxypropyl)-dimethylazanium chloride (PubChem CID 174737498) has the molecular formula C12H19Cl2NO and a molecular weight of 264.20 g/mol. Its IUPAC name is benzyl-(1-chloro-2-hydroxypropyl)-dimethylazanium chloride.
| Compound Name | benzyl-(1-chloro-2-hydroxypropyl)-dimethylazanium chloride |
|---|---|
| PubChem CID | 174737498 |
| Molecular Formula | C12H19Cl2NO |
| Molecular Weight | 264.20 g/mol |
| Exact Mass | 263.08 |
| IUPAC Name | benzyl-(1-chloro-2-hydroxypropyl)-dimethylazanium chloride |
| SMILES | CC(O)C(Cl)[N+](C)(C)Cc1ccccc1.[Cl-] |
| InChI | InChI=1S/C12H19ClNO.ClH/c1-10(15)12(13)14(2,3)9-11-7-5-4-6-8-11;/h4-8,10,12,15H,9H2,1-3H3;1H/q+1;/p-1 |
| InChIKey | KNHURLOXCKASLC-UHFFFAOYSA-M |
| XLogP | -0.79 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.20 |
| LogP ≤ 5 | -0.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'N-C-halo', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|