About benzyl-tert-butyl-dimethylazanium;propan-2-ol
benzyl-tert-butyl-dimethylazanium;propan-2-ol (PubChem CID 174436471) has the molecular formula C16H30NO+
and a molecular weight of 252.42 g/mol. Its IUPAC name is benzyl-tert-butyl-dimethylazanium;propan-2-ol.
Molecular Properties
| Compound Name | benzyl-tert-butyl-dimethylazanium;propan-2-ol |
| PubChem CID | 174436471 |
| Molecular Formula | C16H30NO+ |
| Molecular Weight | 252.42 g/mol |
| Exact Mass | 252.23 |
| IUPAC Name | benzyl-tert-butyl-dimethylazanium;propan-2-ol |
| SMILES | CC(C)(C)[N+](C)(C)Cc1ccccc1.CC(C)O |
| InChI | InChI=1S/C13H22N.C3H8O/c1-13(2,3)14(4,5)11-12-9-7-6-8-10-12;1-3(2)4/h6-10H,11H2,1-5H3;3-4H,1-2H3/q+1; |
| InChIKey | QTRPMGCGJMTAAA-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 252.42 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|
Analyze benzyl-tert-butyl-dimethylazanium;propan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of benzyl-tert-butyl-dimethylazanium;propan-2-ol?
The IUPAC name of benzyl-tert-butyl-dimethylazanium;propan-2-ol (CID 174436471) is benzyl-tert-butyl-dimethylazanium;propan-2-ol.
What is the SMILES notation for benzyl-tert-butyl-dimethylazanium;propan-2-ol?
The canonical SMILES for benzyl-tert-butyl-dimethylazanium;propan-2-ol is CC(C)(C)[N+](C)(C)Cc1ccccc1.CC(C)O.
What is the InChIKey of benzyl-tert-butyl-dimethylazanium;propan-2-ol?
The InChIKey is QTRPMGCGJMTAAA-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H22N.C3H8O/c1-13(2,3)14(4,5)11-12-9-7-6-8-10-12;1-3(2)4/h6-10H,11H2,1-5H3;3-4H,1-2H3/q+1;.
What are the key properties of benzyl-tert-butyl-dimethylazanium;propan-2-ol?
benzyl-tert-butyl-dimethylazanium;propan-2-ol has a molecular weight of 252.42 g/mol, XLogP of 3.45, 2 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for benzyl-tert-butyl-dimethylazanium;propan-2-ol is sourced from PubChem (CID 174436471), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).