C22H30N8O — CID 138600719
4-N-[1-[1-(1-ethylpiperidin-4-yl)oxyisoquinolin-3-yl]ethyl]-5-hydrazinylpyrimidine-4,6-diamine (PubChem CID 138600719) has the molecular formula C22H30N8O and a molecular weight of 422.54 g/mol. Its IUPAC name is 4-N-[1-[1-(1-ethylpiperidin-4-yl)oxyisoquinolin-3-yl]ethyl]-5-hydrazinylpyrimidine-4,6-diamine.
| Compound Name | 4-N-[1-[1-(1-ethylpiperidin-4-yl)oxyisoquinolin-3-yl]ethyl]-5-hydrazinylpyrimidine-4,6-diamine |
|---|---|
| PubChem CID | 138600719 |
| Molecular Formula | C22H30N8O |
| Molecular Weight | 422.54 g/mol |
| Exact Mass | 422.25 |
| IUPAC Name | 4-N-[1-[1-(1-ethylpiperidin-4-yl)oxyisoquinolin-3-yl]ethyl]-5-hydrazinylpyrimidine-4,6-diamine |
| SMILES | CCN1CCC(Oc2nc(C(C)Nc3ncnc(N)c3NN)cc3ccccc23)CC1 |
| InChI | InChI=1S/C22H30N8O/c1-3-30-10-8-16(9-11-30)31-22-17-7-5-4-6-15(17)12-18(28-22)14(2)27-21-19(29-24)20(23)25-13-26-21/h4-7,12-14,16,29H,3,8-11,24H2,1-2H3,(H3,23,25,26,27) |
| InChIKey | NRSQQJFURNDQRQ-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 127.24 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.54 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|