C23H28N8O3S — CID 91608065
1-(8-methyl-7H-purin-6-yl)-2-[1-[1-(1-methylsulfonylpiperidin-4-yl)oxyisoquinolin-3-yl]ethyl]hydrazine (PubChem CID 91608065) has the molecular formula C23H28N8O3S and a molecular weight of 496.60 g/mol. Its IUPAC name is 1-(8-methyl-7H-purin-6-yl)-2-[1-[1-(1-methylsulfonylpiperidin-4-yl)oxyisoquinolin-3-yl]ethyl]hydrazine.
| Compound Name | 1-(8-methyl-7H-purin-6-yl)-2-[1-[1-(1-methylsulfonylpiperidin-4-yl)oxyisoquinolin-3-yl]ethyl]hydrazine |
|---|---|
| PubChem CID | 91608065 |
| Molecular Formula | C23H28N8O3S |
| Molecular Weight | 496.60 g/mol |
| Exact Mass | 496.20 |
| IUPAC Name | 1-(8-methyl-7H-purin-6-yl)-2-[1-[1-(1-methylsulfonylpiperidin-4-yl)oxyisoquinolin-3-yl]ethyl]hydrazine |
| SMILES | Cc1nc2ncnc(NNC(C)c3cc4ccccc4c(OC4CCN(S(C)(=O)=O)CC4)n3)c2[nH]1 |
| InChI | InChI=1S/C23H28N8O3S/c1-14(29-30-22-20-21(24-13-25-22)27-15(2)26-20)19-12-16-6-4-5-7-18(16)23(28-19)34-17-8-10-31(11-9-17)35(3,32)33/h4-7,12-14,17,29H,8-11H2,1-3H3,(H2,24,25,26,27,30) |
| InChIKey | JACCNTDLUGPCPX-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 138.02 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.60 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|