C15H15N5O2 — CID 71689208
N-[1-(1,3-benzodioxol-5-yl)ethyl]-8-methyl-7H-purin-6-amine (PubChem CID 71689208) has the molecular formula C15H15N5O2 and a molecular weight of 297.32 g/mol. Its IUPAC name is N-[1-(1,3-benzodioxol-5-yl)ethyl]-8-methyl-7H-purin-6-amine.
| Compound Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-8-methyl-7H-purin-6-amine |
|---|---|
| PubChem CID | 71689208 |
| Molecular Formula | C15H15N5O2 |
| Molecular Weight | 297.32 g/mol |
| Exact Mass | 297.12 |
| IUPAC Name | N-[1-(1,3-benzodioxol-5-yl)ethyl]-8-methyl-7H-purin-6-amine |
| SMILES | Cc1nc2ncnc(NC(C)c3ccc4c(c3)OCO4)c2[nH]1 |
| InChI | InChI=1S/C15H15N5O2/c1-8(10-3-4-11-12(5-10)22-7-21-11)18-14-13-15(17-6-16-14)20-9(2)19-13/h3-6,8H,7H2,1-2H3,(H2,16,17,18,19,20) |
| InChIKey | FFYULJSTNWWRHZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 84.95 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.32 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |