C15H15N5O3 — CID 56727991
4-[1-(1,3-benzodioxol-5-yl)ethylamino]-7,8-dihydro-5H-pteridin-6-one (PubChem CID 56727991) has the molecular formula C15H15N5O3 and a molecular weight of 313.32 g/mol. Its IUPAC name is 4-[1-(1,3-benzodioxol-5-yl)ethylamino]-7,8-dihydro-5H-pteridin-6-one.
| Compound Name | 4-[1-(1,3-benzodioxol-5-yl)ethylamino]-7,8-dihydro-5H-pteridin-6-one |
|---|---|
| PubChem CID | 56727991 |
| Molecular Formula | C15H15N5O3 |
| Molecular Weight | 313.32 g/mol |
| Exact Mass | 313.12 |
| IUPAC Name | 4-[1-(1,3-benzodioxol-5-yl)ethylamino]-7,8-dihydro-5H-pteridin-6-one |
| SMILES | CC(Nc1ncnc2c1NC(=O)CN2)c1ccc2c(c1)OCO2 |
| InChI | InChI=1S/C15H15N5O3/c1-8(9-2-3-10-11(4-9)23-7-22-10)19-15-13-14(17-6-18-15)16-5-12(21)20-13/h2-4,6,8H,5,7H2,1H3,(H,20,21)(H2,16,17,18,19) |
| InChIKey | MVLBNCMAXWNTPV-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 97.40 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.32 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |