C9H12F9NO — CID 138604544
N-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyethyl]propan-1-amine (PubChem CID 138604544) has the molecular formula C9H12F9NO and a molecular weight of 321.18 g/mol. Its IUPAC name is N-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyethyl]propan-1-amine.
| Compound Name | N-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyethyl]propan-1-amine |
|---|---|
| PubChem CID | 138604544 |
| Molecular Formula | C9H12F9NO |
| Molecular Weight | 321.18 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | N-[2-[1,1,1,3,3,3-hexafluoro-2-(trifluoromethyl)propan-2-yl]oxyethyl]propan-1-amine |
| SMILES | CCCNCCOC(C(F)(F)F)(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C9H12F9NO/c1-2-3-19-4-5-20-6(7(10,11)12,8(13,14)15)9(16,17)18/h19H,2-5H2,1H3 |
| InChIKey | USZHHIFUSZQHFZ-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.18 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|