C13H17N3OS2 — CID 138607876
[4-(disulfanyl)piperazin-1-yl]-(1-pyridin-3-ylcyclopropyl)methanone (PubChem CID 138607876) has the molecular formula C13H17N3OS2 and a molecular weight of 295.43 g/mol. Its IUPAC name is [4-(disulfanyl)piperazin-1-yl]-(1-pyridin-3-ylcyclopropyl)methanone.
| Compound Name | [4-(disulfanyl)piperazin-1-yl]-(1-pyridin-3-ylcyclopropyl)methanone |
|---|---|
| PubChem CID | 138607876 |
| Molecular Formula | C13H17N3OS2 |
| Molecular Weight | 295.43 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | [4-(disulfanyl)piperazin-1-yl]-(1-pyridin-3-ylcyclopropyl)methanone |
| SMILES | O=C(N1CCN(SS)CC1)C1(c2cccnc2)CC1 |
| InChI | InChI=1S/C13H17N3OS2/c17-12(15-6-8-16(19-18)9-7-15)13(3-4-13)11-2-1-5-14-10-11/h1-2,5,10,18H,3-4,6-9H2 |
| InChIKey | OHELEWBYMSELPW-UHFFFAOYSA-N |
| XLogP | 1.75 |
| TPSA | 36.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.43 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|