C20H26N6O4 — CID 138607965
3-[3-[2-(ethylamino)-9-methyl-5-oxo-7,8-dihydropyrimido[4,5-e][1,4]diazepin-6-yl]phenoxy]propyl carbamate (PubChem CID 138607965) has the molecular formula C20H26N6O4 and a molecular weight of 414.47 g/mol. Its IUPAC name is 3-[3-[2-(ethylamino)-9-methyl-5-oxo-7,8-dihydropyrimido[4,5-e][1,4]diazepin-6-yl]phenoxy]propyl carbamate.
| Compound Name | 3-[3-[2-(ethylamino)-9-methyl-5-oxo-7,8-dihydropyrimido[4,5-e][1,4]diazepin-6-yl]phenoxy]propyl carbamate |
|---|---|
| PubChem CID | 138607965 |
| Molecular Formula | C20H26N6O4 |
| Molecular Weight | 414.47 g/mol |
| Exact Mass | 414.20 |
| IUPAC Name | 3-[3-[2-(ethylamino)-9-methyl-5-oxo-7,8-dihydropyrimido[4,5-e][1,4]diazepin-6-yl]phenoxy]propyl carbamate |
| SMILES | CCNc1ncc2c(n1)N(C)CCN(c1cccc(OCCCOC(N)=O)c1)C2=O |
| InChI | InChI=1S/C20H26N6O4/c1-3-22-20-23-13-16-17(24-20)25(2)8-9-26(18(16)27)14-6-4-7-15(12-14)29-10-5-11-30-19(21)28/h4,6-7,12-13H,3,5,8-11H2,1-2H3,(H2,21,28)(H,22,23,24) |
| InChIKey | DOQMZRXGNHWLAT-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 122.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.47 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|