C10H6ClN3OS — CID 138608427
7-(5-chlorothiophen-2-yl)-3H-pyrrolo[2,3-d]pyrimidin-4-one (PubChem CID 138608427) has the molecular formula C10H6ClN3OS and a molecular weight of 251.70 g/mol. Its IUPAC name is 7-(5-chlorothiophen-2-yl)-3H-pyrrolo[2,3-d]pyrimidin-4-one.
| Compound Name | 7-(5-chlorothiophen-2-yl)-3H-pyrrolo[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 138608427 |
| Molecular Formula | C10H6ClN3OS |
| Molecular Weight | 251.70 g/mol |
| Exact Mass | 250.99 |
| IUPAC Name | 7-(5-chlorothiophen-2-yl)-3H-pyrrolo[2,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]cnc2c1ccn2-c1ccc(Cl)s1 |
| InChI | InChI=1S/C10H6ClN3OS/c11-7-1-2-8(16-7)14-4-3-6-9(14)12-5-13-10(6)15/h1-5H,(H,12,13,15) |
| InChIKey | CHEWYASDXYQSRA-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 50.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.70 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |