C23H23Cl2FN2O4 — CID 138610717
N-[3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-1-bicyclo[1.1.1]pentanyl]-3-[(3-chlorophenyl)methoxy]propanamide (PubChem CID 138610717) has the molecular formula C23H23Cl2FN2O4 and a molecular weight of 481.35 g/mol. Its IUPAC name is N-[3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-1-bicyclo[1.1.1]pentanyl]-3-[(3-chlorophenyl)methoxy]propanamide.
| Compound Name | N-[3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-1-bicyclo[1.1.1]pentanyl]-3-[(3-chlorophenyl)methoxy]propanamide |
|---|---|
| PubChem CID | 138610717 |
| Molecular Formula | C23H23Cl2FN2O4 |
| Molecular Weight | 481.35 g/mol |
| Exact Mass | 480.10 |
| IUPAC Name | N-[3-[[2-(4-chloro-3-fluorophenoxy)acetyl]amino]-1-bicyclo[1.1.1]pentanyl]-3-[(3-chlorophenyl)methoxy]propanamide |
| SMILES | O=C(CCOCc1cccc(Cl)c1)NC12CC(NC(=O)COc3ccc(Cl)c(F)c3)(C1)C2 |
| InChI | InChI=1S/C23H23Cl2FN2O4/c24-16-3-1-2-15(8-16)10-31-7-6-20(29)27-22-12-23(13-22,14-22)28-21(30)11-32-17-4-5-18(25)19(26)9-17/h1-5,8-9H,6-7,10-14H2,(H,27,29)(H,28,30) |
| InChIKey | JUTZPFDIVDTZPR-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 481.35 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|