C23H34O7 — CID 138612313
[(3aR,6aS,8S,9R,10R,10aS,10bS)-10-ethyl-3a,9,10a-trihydroxy-5-(hydroxymethyl)-2,7,7,8-tetramethyl-3-oxo-6a,9,10,10b-tetrahydro-4H-benzo[e]azulen-8-yl] acetate (PubChem CID 138612313) has the molecular formula C23H34O7 and a molecular weight of 422.52 g/mol. Its IUPAC name is [(3aR,6aS,8S,9R,10R,10aS,10bS)-10-ethyl-3a,9,10a-trihydroxy-5-(hydroxymethyl)-2,7,7,8-tetramethyl-3-oxo-6a,9,10,10b-tetrahydro-4H-benzo[e]azulen-8-yl] acetate.
| Compound Name | [(3aR,6aS,8S,9R,10R,10aS,10bS)-10-ethyl-3a,9,10a-trihydroxy-5-(hydroxymethyl)-2,7,7,8-tetramethyl-3-oxo-6a,9,10,10b-tetrahydro-4H-benzo[e]azulen-8-yl] acetate |
|---|---|
| PubChem CID | 138612313 |
| Molecular Formula | C23H34O7 |
| Molecular Weight | 422.52 g/mol |
| Exact Mass | 422.23 |
| IUPAC Name | [(3aR,6aS,8S,9R,10R,10aS,10bS)-10-ethyl-3a,9,10a-trihydroxy-5-(hydroxymethyl)-2,7,7,8-tetramethyl-3-oxo-6a,9,10,10b-tetrahydro-4H-benzo[e]azulen-8-yl] acetate |
| SMILES | CC[C@@H]1[C@@H](O)[C@@](C)(OC(C)=O)C(C)(C)[C@@H]2C=C(CO)C[C@]3(O)C(=O)C(C)=C[C@H]3[C@@]12O |
| InChI | InChI=1S/C23H34O7/c1-7-15-19(27)21(6,30-13(3)25)20(4,5)16-9-14(11-24)10-22(28)17(23(15,16)29)8-12(2)18(22)26/h8-9,15-17,19,24,27-29H,7,10-11H2,1-6H3/t15-,16+,17-,19-,21-,22-,23-/m1/s1 |
| InChIKey | LTHSBEMZBVHALN-CSKIERGBSA-N |
| XLogP | 1.28 |
| TPSA | 124.29 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.52 |
| LogP ≤ 5 | 1.28 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|