C22H28O7 — CID 10621237
[(1R,2S,6R,10S,11R,13S,15S)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5,14-dioxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate (PubChem CID 10621237) has the molecular formula C22H28O7 and a molecular weight of 404.46 g/mol. Its IUPAC name is [(1R,2S,6R,10S,11R,13S,15S)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5,14-dioxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate.
| Compound Name | [(1R,2S,6R,10S,11R,13S,15S)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5,14-dioxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate |
|---|---|
| PubChem CID | 10621237 |
| Molecular Formula | C22H28O7 |
| Molecular Weight | 404.46 g/mol |
| Exact Mass | 404.18 |
| IUPAC Name | [(1R,2S,6R,10S,11R,13S,15S)-1,6-dihydroxy-8-(hydroxymethyl)-4,12,12,15-tetramethyl-5,14-dioxo-13-tetracyclo[8.5.0.02,6.011,13]pentadeca-3,8-dienyl] acetate |
| SMILES | CC(=O)O[C@@]12C(=O)[C@@H](C)[C@@]3(O)[C@@H](C=C(CO)C[C@]4(O)C(=O)C(C)=C[C@@H]34)[C@@H]1C2(C)C |
| InChI | InChI=1S/C22H28O7/c1-10-6-15-20(27,17(10)25)8-13(9-23)7-14-16-19(4,5)22(16,29-12(3)24)18(26)11(2)21(14,15)28/h6-7,11,14-16,23,27-28H,8-9H2,1-5H3/t11-,14+,15-,16-,20-,21-,22-/m1/s1 |
| InChIKey | YNLFTDMYXWCBMF-YKPMUSGZSA-N |
| XLogP | 0.71 |
| TPSA | 121.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.46 |
| LogP ≤ 5 | 0.71 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|