C25H24FNO9 — CID 138614725
(7S,9S)-9-acetyl-7-[(2S,4S,5S)-4-amino-5-hydroxyoxan-2-yl]oxy-4-fluoro-6,9,11-trihydroxy-8,10-dihydro-7H-tetracene-5,12-dione (PubChem CID 138614725) has the molecular formula C25H24FNO9 and a molecular weight of 501.46 g/mol. Its IUPAC name is (7S,9S)-9-acetyl-7-[(2S,4S,5S)-4-amino-5-hydroxyoxan-2-yl]oxy-4-fluoro-6,9,11-trihydroxy-8,10-dihydro-7H-tetracene-5,12-dione.
| Compound Name | (7S,9S)-9-acetyl-7-[(2S,4S,5S)-4-amino-5-hydroxyoxan-2-yl]oxy-4-fluoro-6,9,11-trihydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
|---|---|
| PubChem CID | 138614725 |
| Molecular Formula | C25H24FNO9 |
| Molecular Weight | 501.46 g/mol |
| Exact Mass | 501.14 |
| IUPAC Name | (7S,9S)-9-acetyl-7-[(2S,4S,5S)-4-amino-5-hydroxyoxan-2-yl]oxy-4-fluoro-6,9,11-trihydroxy-8,10-dihydro-7H-tetracene-5,12-dione |
| SMILES | CC(=O)[C@]1(O)Cc2c(O)c3c(c(O)c2[C@@H](O[C@H]2C[C@H](N)[C@H](O)CO2)C1)C(=O)c1c(F)cccc1C3=O |
| InChI | InChI=1S/C25H24FNO9/c1-9(28)25(34)6-11-18(15(7-25)36-16-5-13(27)14(29)8-35-16)24(33)20-19(22(11)31)21(30)10-3-2-4-12(26)17(10)23(20)32/h2-4,13-16,29,31,33-34H,5-8,27H2,1H3/t13-,14+,15-,16-,25-/m0/s1 |
| InChIKey | UOYXSLFCHSLYLD-UKTDTPENSA-N |
| XLogP | 0.77 |
| TPSA | 176.61 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 501.46 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'quinone_A(370)', 'substructure': 'N/A'}, {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|