C17H22O — CID 138616015
1-methoxy-4-[(E)-3-(2-methylidenecyclohexyl)prop-1-enyl]benzene (PubChem CID 138616015) has the molecular formula C17H22O and a molecular weight of 242.36 g/mol. Its IUPAC name is 1-methoxy-4-[(E)-3-(2-methylidenecyclohexyl)prop-1-enyl]benzene.
| Compound Name | 1-methoxy-4-[(E)-3-(2-methylidenecyclohexyl)prop-1-enyl]benzene |
|---|---|
| PubChem CID | 138616015 |
| Molecular Formula | C17H22O |
| Molecular Weight | 242.36 g/mol |
| Exact Mass | 242.17 |
| IUPAC Name | 1-methoxy-4-[(E)-3-(2-methylidenecyclohexyl)prop-1-enyl]benzene |
| SMILES | C=C1CCCCC1C/C=C/c1ccc(OC)cc1 |
| InChI | InChI=1S/C17H22O/c1-14-6-3-4-8-16(14)9-5-7-15-10-12-17(18-2)13-11-15/h5,7,10-13,16H,1,3-4,6,8-9H2,2H3/b7-5+ |
| InChIKey | BSRXHDNQTIEBNS-FNORWQNLSA-N |
| XLogP | 4.84 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.36 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|