C14H14N2O4 — CID 70679340
5-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-1,3-diazinane-2,4,6-trione (PubChem CID 70679340) has the molecular formula C14H14N2O4 and a molecular weight of 274.28 g/mol. Its IUPAC name is 5-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 70679340 |
| Molecular Formula | C14H14N2O4 |
| Molecular Weight | 274.28 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 5-[(E)-3-(4-methoxyphenyl)prop-2-enyl]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(/C=C/CC2C(=O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C14H14N2O4/c1-20-10-7-5-9(6-8-10)3-2-4-11-12(17)15-14(19)16-13(11)18/h2-3,5-8,11H,4H2,1H3,(H2,15,16,17,18,19)/b3-2+ |
| InChIKey | IOMOBSKZUJIUGX-NSCUHMNNSA-N |
| XLogP | 1.08 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.28 |
| LogP ≤ 5 | 1.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|