C14H14N2O4S — CID 162393563
5-[(E)-3-(4-methoxyphenyl)-1-sulfanylprop-2-enyl]-1,3-diazinane-2,4,6-trione (PubChem CID 162393563) has the molecular formula C14H14N2O4S and a molecular weight of 306.34 g/mol. Its IUPAC name is 5-[(E)-3-(4-methoxyphenyl)-1-sulfanylprop-2-enyl]-1,3-diazinane-2,4,6-trione.
| Compound Name | 5-[(E)-3-(4-methoxyphenyl)-1-sulfanylprop-2-enyl]-1,3-diazinane-2,4,6-trione |
|---|---|
| PubChem CID | 162393563 |
| Molecular Formula | C14H14N2O4S |
| Molecular Weight | 306.34 g/mol |
| Exact Mass | 306.07 |
| IUPAC Name | 5-[(E)-3-(4-methoxyphenyl)-1-sulfanylprop-2-enyl]-1,3-diazinane-2,4,6-trione |
| SMILES | COc1ccc(/C=C/C(S)C2C(=O)NC(=O)NC2=O)cc1 |
| InChI | InChI=1S/C14H14N2O4S/c1-20-9-5-2-8(3-6-9)4-7-10(21)11-12(17)15-14(19)16-13(11)18/h2-7,10-11,21H,1H3,(H2,15,16,17,18,19)/b7-4+ |
| InChIKey | RJCQSXJQMWQRIY-QPJJXVBHSA-N |
| XLogP | 0.99 |
| TPSA | 84.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.34 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|