C11H13ClO2 — CID 102199471
(E,2S)-1-chloro-4-(4-methoxyphenyl)but-3-en-2-ol (PubChem CID 102199471) has the molecular formula C11H13ClO2 and a molecular weight of 212.68 g/mol. Its IUPAC name is (E,2S)-1-chloro-4-(4-methoxyphenyl)but-3-en-2-ol.
| Compound Name | (E,2S)-1-chloro-4-(4-methoxyphenyl)but-3-en-2-ol |
|---|---|
| PubChem CID | 102199471 |
| Molecular Formula | C11H13ClO2 |
| Molecular Weight | 212.68 g/mol |
| Exact Mass | 212.06 |
| IUPAC Name | (E,2S)-1-chloro-4-(4-methoxyphenyl)but-3-en-2-ol |
| SMILES | COc1ccc(/C=C/[C@H](O)CCl)cc1 |
| InChI | InChI=1S/C11H13ClO2/c1-14-11-6-3-9(4-7-11)2-5-10(13)8-12/h2-7,10,13H,8H2,1H3/b5-2+/t10-/m0/s1 |
| InChIKey | QSFKXXGQAPVDLS-FWYAXHSGSA-N |
| XLogP | 2.31 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.68 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|