C21H31ClO3 — CID 102199475
[(E,2S)-1-chloro-4-(4-methoxyphenyl)but-3-en-2-yl] decanoate (PubChem CID 102199475) has the molecular formula C21H31ClO3 and a molecular weight of 366.93 g/mol. Its IUPAC name is [(E,2S)-1-chloro-4-(4-methoxyphenyl)but-3-en-2-yl] decanoate.
| Compound Name | [(E,2S)-1-chloro-4-(4-methoxyphenyl)but-3-en-2-yl] decanoate |
|---|---|
| PubChem CID | 102199475 |
| Molecular Formula | C21H31ClO3 |
| Molecular Weight | 366.93 g/mol |
| Exact Mass | 366.20 |
| IUPAC Name | [(E,2S)-1-chloro-4-(4-methoxyphenyl)but-3-en-2-yl] decanoate |
| SMILES | CCCCCCCCCC(=O)O[C@@H](/C=C/c1ccc(OC)cc1)CCl |
| InChI | InChI=1S/C21H31ClO3/c1-3-4-5-6-7-8-9-10-21(23)25-20(17-22)16-13-18-11-14-19(24-2)15-12-18/h11-16,20H,3-10,17H2,1-2H3/b16-13+/t20-/m0/s1 |
| InChIKey | DTHDLMZFCBUDDG-YFIXDKARSA-N |
| XLogP | 6.00 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.93 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|